About butyl piperidin-2-yl carbonate
butyl piperidin-2-yl carbonate (PubChem CID 54057815) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is butyl piperidin-2-yl carbonate.
Molecular Properties
| Compound Name | butyl piperidin-2-yl carbonate |
| PubChem CID | 54057815 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | butyl piperidin-2-yl carbonate |
| SMILES | CCCCOC(=O)OC1CCCCN1 |
| InChI | InChI=1S/C10H19NO3/c1-2-3-8-13-10(12)14-9-6-4-5-7-11-9/h9,11H,2-8H2,1H3 |
| InChIKey | GHTSGCRPSVCLJZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl piperidin-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl piperidin-2-yl carbonate?
The IUPAC name of butyl piperidin-2-yl carbonate (CID 54057815) is butyl piperidin-2-yl carbonate.
What is the SMILES notation for butyl piperidin-2-yl carbonate?
The canonical SMILES for butyl piperidin-2-yl carbonate is CCCCOC(=O)OC1CCCCN1.
What is the InChIKey of butyl piperidin-2-yl carbonate?
The InChIKey is GHTSGCRPSVCLJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-3-8-13-10(12)14-9-6-4-5-7-11-9/h9,11H,2-8H2,1H3.
What are the key properties of butyl piperidin-2-yl carbonate?
butyl piperidin-2-yl carbonate has a molecular weight of 201.27 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl piperidin-2-yl carbonate is sourced from PubChem (CID 54057815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).