C11H21NO — CID 45091339
1-(5-methoxy-4-methylcyclohex-3-en-1-yl)-N,N-dimethylmethanamine (PubChem CID 45091339) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 1-(5-methoxy-4-methylcyclohex-3-en-1-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(5-methoxy-4-methylcyclohex-3-en-1-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 45091339 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-(5-methoxy-4-methylcyclohex-3-en-1-yl)-N,N-dimethylmethanamine |
| SMILES | COC1CC(CN(C)C)CC=C1C |
| InChI | InChI=1S/C11H21NO/c1-9-5-6-10(8-12(2)3)7-11(9)13-4/h5,10-11H,6-8H2,1-4H3 |
| InChIKey | KYEKHZHGCSAFCI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|