C11H21NO3 — CID 45092233
tert-butyl-[(2R,3R)-3-hydroxyhex-5-en-2-yl]carbamic acid (PubChem CID 45092233) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-3-hydroxyhex-5-en-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R,3R)-3-hydroxyhex-5-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 45092233 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl-[(2R,3R)-3-hydroxyhex-5-en-2-yl]carbamic acid |
| SMILES | C=CC[C@@H](O)[C@@H](C)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-6-7-9(13)8(2)12(10(14)15)11(3,4)5/h6,8-9,13H,1,7H2,2-5H3,(H,14,15)/t8-,9-/m1/s1 |
| InChIKey | URGNCACTZYQXIN-RKDXNWHRSA-N |
| XLogP | 2.09 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|