C10H19NO2 — CID 59963017
N-ethyl-N-[(2S)-3-hydroxyhex-5-en-2-yl]acetamide (PubChem CID 59963017) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-ethyl-N-[(2S)-3-hydroxyhex-5-en-2-yl]acetamide.
| Compound Name | N-ethyl-N-[(2S)-3-hydroxyhex-5-en-2-yl]acetamide |
|---|---|
| PubChem CID | 59963017 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-ethyl-N-[(2S)-3-hydroxyhex-5-en-2-yl]acetamide |
| SMILES | C=CCC(O)[C@H](C)N(CC)C(C)=O |
| InChI | InChI=1S/C10H19NO2/c1-5-7-10(13)8(3)11(6-2)9(4)12/h5,8,10,13H,1,6-7H2,2-4H3/t8-,10?/m0/s1 |
| InChIKey | WHSWDXMFTTWNBJ-PEHGTWAWSA-N |
| XLogP | 1.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|