C10H20N2O3 — CID 45093416
(2R,3S,4R)-2-(2-morpholin-4-ylethyl)pyrrolidine-3,4-diol (PubChem CID 45093416) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2R,3S,4R)-2-(2-morpholin-4-ylethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(2-morpholin-4-ylethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 45093416 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2R,3S,4R)-2-(2-morpholin-4-ylethyl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CN[C@@H]1CCN1CCOCC1 |
| InChI | InChI=1S/C10H20N2O3/c13-9-7-11-8(10(9)14)1-2-12-3-5-15-6-4-12/h8-11,13-14H,1-7H2/t8-,9-,10+/m1/s1 |
| InChIKey | LGZVJJAJXUUISE-BBBLOLIVSA-N |
| XLogP | -1.60 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |