About ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate
ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate (PubChem CID 45094311) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate.
Analyze ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate?
The IUPAC name of ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate (CID 45094311) is ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate.
What is the SMILES notation for ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate?
The canonical SMILES for ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate is CCOC(=O)C1=C(C)NCCC1OCC.
What is the InChIKey of ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate?
The InChIKey is ITOIXGCUYBCNLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-4-14-9-6-7-12-8(3)10(9)11(13)15-5-2/h9,12H,4-7H2,1-3H3.
What are the key properties of ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate?
ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethoxy-6-methyl-1,2,3,4-tetrahydropyridine-5-carboxylate is sourced from PubChem (CID 45094311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).