About 4-propan-2-ylthian-4-ol
4-propan-2-ylthian-4-ol (PubChem CID 45096107) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is 4-propan-2-ylthian-4-ol.
Molecular Properties
| Compound Name | 4-propan-2-ylthian-4-ol |
| PubChem CID | 45096107 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 4-propan-2-ylthian-4-ol |
| SMILES | CC(C)C1(O)CCSCC1 |
| InChI | InChI=1S/C8H16OS/c1-7(2)8(9)3-5-10-6-4-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | JDQNWGWKTWMLDN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-ylthian-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylthian-4-ol?
The IUPAC name of 4-propan-2-ylthian-4-ol (CID 45096107) is 4-propan-2-ylthian-4-ol.
What is the SMILES notation for 4-propan-2-ylthian-4-ol?
The canonical SMILES for 4-propan-2-ylthian-4-ol is CC(C)C1(O)CCSCC1.
What is the InChIKey of 4-propan-2-ylthian-4-ol?
The InChIKey is JDQNWGWKTWMLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS/c1-7(2)8(9)3-5-10-6-4-8/h7,9H,3-6H2,1-2H3.
What are the key properties of 4-propan-2-ylthian-4-ol?
4-propan-2-ylthian-4-ol has a molecular weight of 160.28 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylthian-4-ol is sourced from PubChem (CID 45096107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).