C9H14N2O2 — CID 45099837
(3S,6R)-3,6-dimethyl-1-prop-2-enylpiperazine-2,5-dione (PubChem CID 45099837) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3S,6R)-3,6-dimethyl-1-prop-2-enylpiperazine-2,5-dione.
| Compound Name | (3S,6R)-3,6-dimethyl-1-prop-2-enylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 45099837 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3S,6R)-3,6-dimethyl-1-prop-2-enylpiperazine-2,5-dione |
| SMILES | C=CCN1C(=O)[C@H](C)NC(=O)[C@H]1C |
| InChI | InChI=1S/C9H14N2O2/c1-4-5-11-7(3)8(12)10-6(2)9(11)13/h4,6-7H,1,5H2,2-3H3,(H,10,12)/t6-,7+/m0/s1 |
| InChIKey | ZAKWKBMCCAHXII-NKWVEPMBSA-N |
| XLogP | -0.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|