C21H27NO3 — CID 45100850
2-[(2,4-dimethoxyphenyl)methyl-prop-2-enylamino]-3-phenylpropan-1-ol (PubChem CID 45100850) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl-prop-2-enylamino]-3-phenylpropan-1-ol.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl-prop-2-enylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 45100850 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl-prop-2-enylamino]-3-phenylpropan-1-ol |
| SMILES | C=CCN(Cc1ccc(OC)cc1OC)C(CO)Cc1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-4-12-22(19(16-23)13-17-8-6-5-7-9-17)15-18-10-11-20(24-2)14-21(18)25-3/h4-11,14,19,23H,1,12-13,15-16H2,2-3H3 |
| InChIKey | XGBWUIOTWRLLOA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|