C22H18Cl2N4O — CID 45101085
6-amino-4-(2,4-dichlorophenyl)-1-phenyl-3-propan-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 45101085) has the molecular formula C22H18Cl2N4O and a molecular weight of 425.32 g/mol. Its IUPAC name is 6-amino-4-(2,4-dichlorophenyl)-1-phenyl-3-propan-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(2,4-dichlorophenyl)-1-phenyl-3-propan-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 45101085 |
| Molecular Formula | C22H18Cl2N4O |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 6-amino-4-(2,4-dichlorophenyl)-1-phenyl-3-propan-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | CC(C)c1nn(-c2ccccc2)c2c1C(c1ccc(Cl)cc1Cl)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C22H18Cl2N4O/c1-12(2)20-19-18(15-9-8-13(23)10-17(15)24)16(11-25)21(26)29-22(19)28(27-20)14-6-4-3-5-7-14/h3-10,12,18H,26H2,1-2H3 |
| InChIKey | KKGDDMHMUTZMDK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|