C20H10Cl3F3N4O — CID 2753710
6-amino-1-phenyl-4-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 2753710) has the molecular formula C20H10Cl3F3N4O and a molecular weight of 485.68 g/mol. Its IUPAC name is 6-amino-1-phenyl-4-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-1-phenyl-4-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 2753710 |
| Molecular Formula | C20H10Cl3F3N4O |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | 6-amino-1-phenyl-4-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(C(F)(F)F)nn2-c2ccccc2)C1c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H10Cl3F3N4O/c21-9-6-12(22)15(13(23)7-9)14-11(8-27)18(28)31-19-16(14)17(20(24,25)26)29-30(19)10-4-2-1-3-5-10/h1-7,14H,28H2 |
| InChIKey | AUDQHQPZJUABRT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|