C20H31NO4 — CID 45101463
(1R,5R,8S,9S,13S,14E)-8-hydroxy-14-hydroxyimino-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 45101463) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (1R,5R,8S,9S,13S,14E)-8-hydroxy-14-hydroxyimino-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1R,5R,8S,9S,13S,14E)-8-hydroxy-14-hydroxyimino-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 45101463 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (1R,5R,8S,9S,13S,14E)-8-hydroxy-14-hydroxyimino-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C[C@@]12CCC3[C@@](CCC4[C@@]3(C)[C@@H](O)CC[C@@]4(C)C(=O)O)(C/C1=N\O)C2 |
| InChI | InChI=1S/C20H31NO4/c1-17-7-4-13-19(3)12(18(2,16(23)24)8-6-15(19)22)5-9-20(13,11-17)10-14(17)21-25/h12-13,15,22,25H,4-11H2,1-3H3,(H,23,24)/b21-14+/t12?,13?,15-,17-,18+,19+,20-/m0/s1 |
| InChIKey | NMDZQGWOEXGBIT-QKZKETCUSA-N |
| XLogP | 3.67 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|