C20H30O4 — CID 75221055
8,14-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid (PubChem CID 75221055) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 8,14-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid.
| Compound Name | 8,14-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 75221055 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 8,14-dihydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid |
| SMILES | CC1(O)CC23CCC4C(C)(C(=O)O)CCC(O)C4(C)C2C=CC1C3 |
| InChI | InChI=1S/C20H30O4/c1-17(16(22)23)8-7-15(21)19(3)13(17)6-9-20-10-12(4-5-14(19)20)18(2,24)11-20/h4-5,12-15,21,24H,6-11H2,1-3H3,(H,22,23) |
| InChIKey | GNSDUTWQMBDEOG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|