C17H21N3O4S2 — CID 45103679
[(2S,3S)-3-azido-2-hydroxy-4-thiophen-2-ylbutyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 45103679) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is [(2S,3S)-3-azido-2-hydroxy-4-thiophen-2-ylbutyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2S,3S)-3-azido-2-hydroxy-4-thiophen-2-ylbutyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 45103679 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(2S,3S)-3-azido-2-hydroxy-4-thiophen-2-ylbutyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)OC[C@@H](O)[C@H](Cc2cccs2)N=[N+]=[N-])c(C)c1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-11-7-12(2)17(13(3)8-11)26(22,23)24-10-16(21)15(19-20-18)9-14-5-4-6-25-14/h4-8,15-16,21H,9-10H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | OTUOLEMVGYIJIY-JKSUJKDBSA-N |
| XLogP | 3.66 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|