C18H14N4O2S — CID 45104986
15-ethyl-14λ6-thia-2,9,11,15-tetrazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3,5,7,9,11,16,18,20-nonaene 14,14-dioxide (PubChem CID 45104986) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 15-ethyl-14λ6-thia-2,9,11,15-tetrazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3,5,7,9,11,16,18,20-nonaene 14,14-dioxide.
| Compound Name | 15-ethyl-14λ6-thia-2,9,11,15-tetrazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3,5,7,9,11,16,18,20-nonaene 14,14-dioxide |
|---|---|
| PubChem CID | 45104986 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 15-ethyl-14λ6-thia-2,9,11,15-tetrazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3,5,7,9,11,16,18,20-nonaene 14,14-dioxide |
| SMILES | CCN1c2ccccc2-c2c(cnc3nc4ccccc4n23)S1(=O)=O |
| InChI | InChI=1S/C18H14N4O2S/c1-2-21-14-9-5-3-7-12(14)17-16(25(21,23)24)11-19-18-20-13-8-4-6-10-15(13)22(17)18/h3-11H,2H2,1H3 |
| InChIKey | JWBBVQJNWFPEMS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |