C19H16Cl3N2O2S- — CID 45108798
4-chloro-N-(4-chlorophenyl)-N-(2-pyridin-2-ylethyl)benzenesulfonamide chloride (PubChem CID 45108798) has the molecular formula C19H16Cl3N2O2S- and a molecular weight of 442.78 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-N-(2-pyridin-2-ylethyl)benzenesulfonamide chloride.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-N-(2-pyridin-2-ylethyl)benzenesulfonamide chloride |
|---|---|
| PubChem CID | 45108798 |
| Molecular Formula | C19H16Cl3N2O2S- |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-N-(2-pyridin-2-ylethyl)benzenesulfonamide chloride |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(CCc1ccccn1)c1ccc(Cl)cc1.[Cl-] |
| InChI | InChI=1S/C19H16Cl2N2O2S.ClH/c20-15-4-8-18(9-5-15)23(14-12-17-3-1-2-13-22-17)26(24,25)19-10-6-16(21)7-11-19;/h1-11,13H,12,14H2;1H/p-1 |
| InChIKey | SWEHYOPMCIYTEM-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |