C21H22N4O4S2 — CID 45109664
[(E)-4-phenylmethoxybut-2-enyl] N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate (PubChem CID 45109664) has the molecular formula C21H22N4O4S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is [(E)-4-phenylmethoxybut-2-enyl] N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate.
| Compound Name | [(E)-4-phenylmethoxybut-2-enyl] N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate |
|---|---|
| PubChem CID | 45109664 |
| Molecular Formula | C21H22N4O4S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [(E)-4-phenylmethoxybut-2-enyl] N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate |
| SMILES | Cc1csc2c(SCC(=O)NNC(=O)OC/C=C/COCc3ccccc3)ncnc12 |
| InChI | InChI=1S/C21H22N4O4S2/c1-15-12-30-19-18(15)22-14-23-20(19)31-13-17(26)24-25-21(27)29-10-6-5-9-28-11-16-7-3-2-4-8-16/h2-8,12,14H,9-11,13H2,1H3,(H,24,26)(H,25,27)/b6-5+ |
| InChIKey | WKPAFLPSJIQKOK-AATRIKPKSA-N |
| XLogP | 3.62 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|