C27H32ClN3O2 — CID 45110513
2-[2-(4-chlorophenyl)indazol-3-yl]-2-cyclohexyl-N-(4-hydroxycyclohexyl)acetamide (PubChem CID 45110513) has the molecular formula C27H32ClN3O2 and a molecular weight of 466.03 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)indazol-3-yl]-2-cyclohexyl-N-(4-hydroxycyclohexyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)indazol-3-yl]-2-cyclohexyl-N-(4-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 45110513 |
| Molecular Formula | C27H32ClN3O2 |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-[2-(4-chlorophenyl)indazol-3-yl]-2-cyclohexyl-N-(4-hydroxycyclohexyl)acetamide |
| SMILES | O=C(NC1CCC(O)CC1)C(c1c2ccccc2nn1-c1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H32ClN3O2/c28-19-10-14-21(15-11-19)31-26(23-8-4-5-9-24(23)30-31)25(18-6-2-1-3-7-18)27(33)29-20-12-16-22(32)17-13-20/h4-5,8-11,14-15,18,20,22,25,32H,1-3,6-7,12-13,16-17H2,(H,29,33) |
| InChIKey | DYKWLSGPUDZRKM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |