C26H31ClN4O — CID 46182762
1-[2-(4-chlorophenyl)indazol-3-yl]-1,3-dicyclohexylurea (PubChem CID 46182762) has the molecular formula C26H31ClN4O and a molecular weight of 451.01 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)indazol-3-yl]-1,3-dicyclohexylurea.
| Compound Name | 1-[2-(4-chlorophenyl)indazol-3-yl]-1,3-dicyclohexylurea |
|---|---|
| PubChem CID | 46182762 |
| Molecular Formula | C26H31ClN4O |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[2-(4-chlorophenyl)indazol-3-yl]-1,3-dicyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N(c1c2ccccc2nn1-c1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C26H31ClN4O/c27-19-15-17-22(18-16-19)31-25(23-13-7-8-14-24(23)29-31)30(21-11-5-2-6-12-21)26(32)28-20-9-3-1-4-10-20/h7-8,13-18,20-21H,1-6,9-12H2,(H,28,32) |
| InChIKey | TUOGRYKIOZCKTQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |