C18H26O2 — CID 45111218
(1E,4E)-1-(oxolan-2-yl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one (PubChem CID 45111218) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1E,4E)-1-(oxolan-2-yl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(oxolan-2-yl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 45111218 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1E,4E)-1-(oxolan-2-yl)-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=C(/C=C/C(=O)/C=C/C2CCCO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H26O2/c1-14-6-4-12-18(2,3)17(14)11-9-15(19)8-10-16-7-5-13-20-16/h8-11,16H,4-7,12-13H2,1-3H3/b10-8+,11-9+ |
| InChIKey | FIUCQTHIIMTJNX-GFULKKFKSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|