C22H23N3O3S — CID 45111504
N-[4-[(2,4,6-trimethylphenyl)methylsulfamoyl]phenyl]pyridine-2-carboxamide (PubChem CID 45111504) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-[(2,4,6-trimethylphenyl)methylsulfamoyl]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-[(2,4,6-trimethylphenyl)methylsulfamoyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45111504 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4-[(2,4,6-trimethylphenyl)methylsulfamoyl]phenyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c(CNS(=O)(=O)c2ccc(NC(=O)c3ccccn3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15-12-16(2)20(17(3)13-15)14-24-29(27,28)19-9-7-18(8-10-19)25-22(26)21-6-4-5-11-23-21/h4-13,24H,14H2,1-3H3,(H,25,26) |
| InChIKey | MPVLWFSXOHJXKJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |