C5H5FN2OS — CID 45121951
2-fluoro-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 45121951) has the molecular formula C5H5FN2OS and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-fluoro-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-fluoro-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 45121951 |
| Molecular Formula | C5H5FN2OS |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 2-fluoro-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CF)Nc1nccs1 |
| InChI | InChI=1S/C5H5FN2OS/c6-3-4(9)8-5-7-1-2-10-5/h1-2H,3H2,(H,7,8,9) |
| InChIKey | IQYIYQDDHDGQNW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |