C24H25NO4 — CID 45123130
2,4-diphenyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine (PubChem CID 45123130) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2,4-diphenyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine.
| Compound Name | 2,4-diphenyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 45123130 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2,4-diphenyl-3-(3,4,5-trimethoxyphenyl)-1,2-oxazolidine |
| SMILES | COc1cc(C2C(c3ccccc3)CON2c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H25NO4/c1-26-21-14-18(15-22(27-2)24(21)28-3)23-20(17-10-6-4-7-11-17)16-29-25(23)19-12-8-5-9-13-19/h4-15,20,23H,16H2,1-3H3 |
| InChIKey | OOXLYZJMLMWROZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |