C21H21N3O5 — CID 98084751
(7R,7aS)-1-phenyl-7-(3,4,5-trimethoxyphenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione (PubChem CID 98084751) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is (7R,7aS)-1-phenyl-7-(3,4,5-trimethoxyphenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione.
| Compound Name | (7R,7aS)-1-phenyl-7-(3,4,5-trimethoxyphenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 98084751 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (7R,7aS)-1-phenyl-7-(3,4,5-trimethoxyphenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione |
| SMILES | COc1cc([C@H]2CC(=O)NC3=NC(=O)N(c4ccccc4)[C@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N3O5/c1-27-15-9-12(10-16(28-2)19(15)29-3)14-11-17(25)22-20-18(14)24(21(26)23-20)13-7-5-4-6-8-13/h4-10,14,18H,11H2,1-3H3,(H,22,23,25,26)/t14-,18+/m1/s1 |
| InChIKey | BDBILAUCZYGTAO-KDOFPFPSSA-N |
| XLogP | 2.72 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |