C19H14ClN3O4 — CID 124891178
(7R,7aS)-7-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione (PubChem CID 124891178) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is (7R,7aS)-7-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione.
| Compound Name | (7R,7aS)-7-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 124891178 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (7R,7aS)-7-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-4,6,7,7a-tetrahydroimidazo[4,5-b]pyridine-2,5-dione |
| SMILES | O=C1C[C@H](c2ccc3c(c2)OCO3)[C@H]2C(=NC(=O)N2c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C19H14ClN3O4/c20-11-2-4-12(5-3-11)23-17-13(8-16(24)21-18(17)22-19(23)25)10-1-6-14-15(7-10)27-9-26-14/h1-7,13,17H,8-9H2,(H,21,22,24,25)/t13-,17+/m1/s1 |
| InChIKey | LEJNNAHBUPUGTH-DYVFJYSZSA-N |
| XLogP | 3.08 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |