C23H23N3O7 — CID 124890945
(7S,7aS)-7-(1,3-benzodioxol-5-yl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione (PubChem CID 124890945) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is (7S,7aS)-7-(1,3-benzodioxol-5-yl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione.
| Compound Name | (7S,7aS)-7-(1,3-benzodioxol-5-yl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 124890945 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (7S,7aS)-7-(1,3-benzodioxol-5-yl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione |
| SMILES | COc1cc(N2C(=O)C[C@@H](c3ccc4c(c3)OCO4)[C@H]3C2=NC(=O)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C23H23N3O7/c1-25-20-14(12-5-6-15-16(7-12)33-11-32-15)10-19(27)26(22(20)24-23(25)28)13-8-17(29-2)21(31-4)18(9-13)30-3/h5-9,14,20H,10-11H2,1-4H3/t14-,20-/m0/s1 |
| InChIKey | CHWOBDDXTVCWEE-XOBRGWDASA-N |
| XLogP | 2.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |