C23H25N3O6 — CID 124891572
(7S,7aR)-7-(4-methoxyphenyl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione (PubChem CID 124891572) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (7S,7aR)-7-(4-methoxyphenyl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione.
| Compound Name | (7S,7aR)-7-(4-methoxyphenyl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 124891572 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (7S,7aR)-7-(4-methoxyphenyl)-1-methyl-4-(3,4,5-trimethoxyphenyl)-7,7a-dihydro-6H-imidazo[4,5-b]pyridine-2,5-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)N(c3cc(OC)c(OC)c(OC)c3)C3=NC(=O)N(C)[C@@H]32)cc1 |
| InChI | InChI=1S/C23H25N3O6/c1-25-20-16(13-6-8-15(29-2)9-7-13)12-19(27)26(22(20)24-23(25)28)14-10-17(30-3)21(32-5)18(11-14)31-4/h6-11,16,20H,12H2,1-5H3/t16-,20+/m0/s1 |
| InChIKey | VSZUODXXMZFPDQ-OXJNMPFZSA-N |
| XLogP | 3.07 |
| TPSA | 89.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |