C16H20N4O3 — CID 45123655
(1E)-N-(4-ethoxyanilino)-2-oxo-2-(oxolan-2-ylmethylamino)ethanimidoyl cyanide (PubChem CID 45123655) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (1E)-N-(4-ethoxyanilino)-2-oxo-2-(oxolan-2-ylmethylamino)ethanimidoyl cyanide.
| Compound Name | (1E)-N-(4-ethoxyanilino)-2-oxo-2-(oxolan-2-ylmethylamino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 45123655 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1E)-N-(4-ethoxyanilino)-2-oxo-2-(oxolan-2-ylmethylamino)ethanimidoyl cyanide |
| SMILES | CCOc1ccc(N/N=C(\C#N)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H20N4O3/c1-2-22-13-7-5-12(6-8-13)19-20-15(10-17)16(21)18-11-14-4-3-9-23-14/h5-8,14,19H,2-4,9,11H2,1H3,(H,18,21)/b20-15+ |
| InChIKey | LYZWUVGKOFDVGE-HMMYKYKNSA-N |
| XLogP | 1.67 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|