C16H25N3O7 — CID 45141491
N-(2-aminoethyl)-4-[[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]oxymethyl]benzamide (PubChem CID 45141491) has the molecular formula C16H25N3O7 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]oxymethyl]benzamide.
| Compound Name | N-(2-aminoethyl)-4-[[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]oxymethyl]benzamide |
|---|---|
| PubChem CID | 45141491 |
| Molecular Formula | C16H25N3O7 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-(2-aminoethyl)-4-[[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]oxymethyl]benzamide |
| SMILES | NCCNC(=O)c1ccc(CO/N=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C16H25N3O7/c17-5-6-18-16(25)11-3-1-10(2-4-11)9-26-19-7-12(21)14(23)15(24)13(22)8-20/h1-4,7,12-15,20-24H,5-6,8-9,17H2,(H,18,25)/b19-7+/t12-,13+,14+,15+/m0/s1 |
| InChIKey | PQDIHHVADYCRNT-AKTRAGCZSA-N |
| XLogP | -2.69 |
| TPSA | 177.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|