C19H25NO6 — CID 45142018
(E)-but-2-enedioic acid;1-(3-methoxyphenyl)-2-piperidin-1-ylpropan-1-one (PubChem CID 45142018) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(3-methoxyphenyl)-2-piperidin-1-ylpropan-1-one.
| Compound Name | (E)-but-2-enedioic acid;1-(3-methoxyphenyl)-2-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 45142018 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(3-methoxyphenyl)-2-piperidin-1-ylpropan-1-one |
| SMILES | COc1cccc(C(=O)C(C)N2CCCCC2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H21NO2.C4H4O4/c1-12(16-9-4-3-5-10-16)15(17)13-7-6-8-14(11-13)18-2;5-3(6)1-2-4(7)8/h6-8,11-12H,3-5,9-10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OCKAUAVIUKCVGQ-WLHGVMLRSA-N |
| XLogP | 2.46 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|