C19H16N2O2S2 — CID 4514282
N-[5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide (PubChem CID 4514282) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 4514282 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[5-[(2-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide |
| SMILES | Cc1ccccc1C=C1SC(=S)N(NC(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H16N2O2S2/c1-13-7-5-6-10-15(13)12-16-18(23)21(19(24)25-16)20-17(22)11-14-8-3-2-4-9-14/h2-10,12H,11H2,1H3,(H,20,22) |
| InChIKey | QMLRCLFTMPWQDO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|