C18H12Cl2N2O2S2 — CID 4515033
N-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide (PubChem CID 4515033) has the molecular formula C18H12Cl2N2O2S2 and a molecular weight of 423.35 g/mol. Its IUPAC name is N-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 4515033 |
| Molecular Formula | C18H12Cl2N2O2S2 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | N-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN1C(=O)C(=Cc2ccc(Cl)cc2Cl)SC1=S |
| InChI | InChI=1S/C18H12Cl2N2O2S2/c19-13-7-6-12(14(20)10-13)9-15-17(24)22(18(25)26-15)21-16(23)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,21,23) |
| InChIKey | AWURBUVNUNMQEF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|