C25H27N3O3 — CID 45146203
1-[(E)-[4-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]-3-phenylurea (PubChem CID 45146203) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[(E)-[4-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-[4-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 45146203 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-[(E)-[4-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]-3-phenylurea |
| SMILES | Cc1cccc(C)c1OCCCOc1ccc(/C=N/NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-19-8-6-9-20(2)24(19)31-17-7-16-30-23-14-12-21(13-15-23)18-26-28-25(29)27-22-10-4-3-5-11-22/h3-6,8-15,18H,7,16-17H2,1-2H3,(H2,27,28,29)/b26-18+ |
| InChIKey | CJPRJQUXGQTMCE-NLRVBDNBSA-N |
| XLogP | 5.31 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|