C17H16N3O4- — CID 6876114
2-[4-[(E)-[(4-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate (PubChem CID 6876114) has the molecular formula C17H16N3O4- and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-[4-[(E)-[(4-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-[(4-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6876114 |
| Molecular Formula | C17H16N3O4- |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[4-[(E)-[(4-methylphenyl)carbamoylhydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1ccc(NC(=O)N/N=C/c2ccc(OCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H17N3O4/c1-12-2-6-14(7-3-12)19-17(23)20-18-10-13-4-8-15(9-5-13)24-11-16(21)22/h2-10H,11H2,1H3,(H,21,22)(H2,19,20,23)/p-1/b18-10+ |
| InChIKey | DMNDCEHVDAUQRF-VCHYOVAHSA-M |
| XLogP | 1.28 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|