C19H15N5OS — CID 45146323
(E)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine (PubChem CID 45146323) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is (E)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine.
| Compound Name | (E)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine |
|---|---|
| PubChem CID | 45146323 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (E)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine |
| SMILES | C(=N/n1c(SCc2ccccc2)nnc1-c1ccncc1)\c1ccco1 |
| InChI | InChI=1S/C19H15N5OS/c1-2-5-15(6-3-1)14-26-19-23-22-18(16-8-10-20-11-9-16)24(19)21-13-17-7-4-12-25-17/h1-13H,14H2/b21-13+ |
| InChIKey | TWUUCWXFDWQNNT-FYJGNVAPSA-N |
| XLogP | 4.11 |
| TPSA | 69.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|