C23H34N2OS — CID 45155759
(10S,13S)-10,13-dimethyl-16-(1-methylimidazol-2-yl)sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 45155759) has the molecular formula C23H34N2OS and a molecular weight of 386.61 g/mol. Its IUPAC name is (10S,13S)-10,13-dimethyl-16-(1-methylimidazol-2-yl)sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (10S,13S)-10,13-dimethyl-16-(1-methylimidazol-2-yl)sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 45155759 |
| Molecular Formula | C23H34N2OS |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (10S,13S)-10,13-dimethyl-16-(1-methylimidazol-2-yl)sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | Cn1ccnc1SC1CC2C3CCC4CCCC[C@]4(C)C3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C23H34N2OS/c1-22-10-5-4-6-15(22)7-8-16-17(22)9-11-23(2)18(16)14-19(20(23)26)27-21-24-12-13-25(21)3/h12-13,15-19H,4-11,14H2,1-3H3/t15?,16?,17?,18?,19?,22-,23-/m0/s1 |
| InChIKey | PHRHHWODCHHSQV-VYXMTPKESA-N |
| XLogP | 5.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |