C11H12N2O3 — CID 45156473
3-(2-aminoethyl)-5-phenyl-1,3-oxazolidine-2,4-dione (PubChem CID 45156473) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-phenyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(2-aminoethyl)-5-phenyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 45156473 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(2-aminoethyl)-5-phenyl-1,3-oxazolidine-2,4-dione |
| SMILES | NCCN1C(=O)OC(c2ccccc2)C1=O |
| InChI | InChI=1S/C11H12N2O3/c12-6-7-13-10(14)9(16-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7,12H2 |
| InChIKey | QIPZWHWAOLBFOY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |