C23H37N5O — CID 45160910
azepan-1-yl-[5-(4-ethylpiperazin-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 45160910) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is azepan-1-yl-[5-(4-ethylpiperazin-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | azepan-1-yl-[5-(4-ethylpiperazin-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 45160910 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | azepan-1-yl-[5-(4-ethylpiperazin-1-yl)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCCCCC2)c2c1CCC(N1CCN(CC)CC1)C2 |
| InChI | InChI=1S/C23H37N5O/c1-3-11-28-21-10-9-19(26-16-14-25(4-2)15-17-26)18-20(21)22(24-28)23(29)27-12-7-5-6-8-13-27/h3,19H,1,4-18H2,2H3 |
| InChIKey | SUXSMAXWYSFQQG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|