C19H28N4 — CID 45168889
N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-(3-phenylpropyl)piperidin-3-amine (PubChem CID 45168889) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-(3-phenylpropyl)piperidin-3-amine.
| Compound Name | N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-(3-phenylpropyl)piperidin-3-amine |
|---|---|
| PubChem CID | 45168889 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-(3-phenylpropyl)piperidin-3-amine |
| SMILES | Cc1cnc(CNC2CCCN(CCCc3ccccc3)C2)[nH]1 |
| InChI | InChI=1S/C19H28N4/c1-16-13-21-19(22-16)14-20-18-10-6-12-23(15-18)11-5-9-17-7-3-2-4-8-17/h2-4,7-8,13,18,20H,5-6,9-12,14-15H2,1H3,(H,21,22) |
| InChIKey | PBYXGHXSIFMILC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |