C19H26N2O — CID 45222723
N-(furan-2-ylmethyl)-1-(3-phenylpropyl)piperidin-3-amine (PubChem CID 45222723) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(3-phenylpropyl)piperidin-3-amine.
| Compound Name | N-(furan-2-ylmethyl)-1-(3-phenylpropyl)piperidin-3-amine |
|---|---|
| PubChem CID | 45222723 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(3-phenylpropyl)piperidin-3-amine |
| SMILES | c1ccc(CCCN2CCCC(NCc3ccco3)C2)cc1 |
| InChI | InChI=1S/C19H26N2O/c1-2-7-17(8-3-1)9-4-12-21-13-5-10-18(16-21)20-15-19-11-6-14-22-19/h1-3,6-8,11,14,18,20H,4-5,9-10,12-13,15-16H2 |
| InChIKey | VGWBPGXNMWBIFN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |