C20H28N4 — CID 70779671
4,6-dimethyl-N-[1-(3-phenylpropyl)piperidin-3-yl]pyrimidin-2-amine (PubChem CID 70779671) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 4,6-dimethyl-N-[1-(3-phenylpropyl)piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[1-(3-phenylpropyl)piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70779671 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 4,6-dimethyl-N-[1-(3-phenylpropyl)piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NC2CCCN(CCCc3ccccc3)C2)n1 |
| InChI | InChI=1S/C20H28N4/c1-16-14-17(2)22-20(21-16)23-19-11-7-13-24(15-19)12-6-10-18-8-4-3-5-9-18/h3-5,8-9,14,19H,6-7,10-13,15H2,1-2H3,(H,21,22,23) |
| InChIKey | HLEZDSUPURBVTL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |