C15H23FN2O2S — CID 45174478
3-[2-(3-fluorophenyl)ethyl]-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 45174478) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethyl]-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | 3-[2-(3-fluorophenyl)ethyl]-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 45174478 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethyl]-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H23FN2O2S/c1-17(2)21(19,20)18-10-4-6-14(12-18)9-8-13-5-3-7-15(16)11-13/h3,5,7,11,14H,4,6,8-10,12H2,1-2H3 |
| InChIKey | GQHXTXHHNOZALN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |