C19H23F3N2OS — CID 45174587
2-[1-(thiophen-2-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]ethanol (PubChem CID 45174587) has the molecular formula C19H23F3N2OS and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[1-(thiophen-2-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-(thiophen-2-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45174587 |
| Molecular Formula | C19H23F3N2OS |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[1-(thiophen-2-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(Cc2cccc(C(F)(F)F)c2)CCN1Cc1cccs1 |
| InChI | InChI=1S/C19H23F3N2OS/c20-19(21,22)16-4-1-3-15(11-16)12-23-7-8-24(17(13-23)6-9-25)14-18-5-2-10-26-18/h1-5,10-11,17,25H,6-9,12-14H2 |
| InChIKey | XHSFORFUJLZROR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |