C23H36N9O4S+ — CID 4517623
4-[5-[3-[3-[4-(diazonioamino)-2-nitroanilino]propyl-methylamino]propylamino]-5-oxopentyl]-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 4517623) has the molecular formula C23H36N9O4S+ and a molecular weight of 534.67 g/mol. Its IUPAC name is 4-[5-[3-[3-[4-(diazonioamino)-2-nitroanilino]propyl-methylamino]propylamino]-5-oxopentyl]-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | 4-[5-[3-[3-[4-(diazonioamino)-2-nitroanilino]propyl-methylamino]propylamino]-5-oxopentyl]-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 4517623 |
| Molecular Formula | C23H36N9O4S+ |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 4-[5-[3-[3-[4-(diazonioamino)-2-nitroanilino]propyl-methylamino]propylamino]-5-oxopentyl]-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | CN(CCCNC(=O)CCCCC1SCC2NC(=O)NC21)CCCNc1ccc(N[N+]#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H35N9O4S/c1-31(12-4-10-25-17-9-8-16(29-30-24)14-19(17)32(35)36)13-5-11-26-21(33)7-3-2-6-20-22-18(15-37-20)27-23(34)28-22/h8-9,14,18,20,22,24H,2-7,10-13,15H2,1H3,(H3,26,27,28,33,34)/p+1 |
| InChIKey | DHQQRVNFXAJHDU-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|