C20H32N6O — CID 45182627
1-[[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]triazol-4-yl]methyl]-1,4-diazepan-5-one (PubChem CID 45182627) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]triazol-4-yl]methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]triazol-4-yl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 45182627 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]triazol-4-yl]methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(Cc2cn(C3CCN(CC4CC=CCC4)CC3)nn2)CCN1 |
| InChI | InChI=1S/C20H32N6O/c27-20-8-12-25(13-9-21-20)15-18-16-26(23-22-18)19-6-10-24(11-7-19)14-17-4-2-1-3-5-17/h1-2,16-17,19H,3-15H2,(H,21,27) |
| InChIKey | DWVFKIWVTSJADQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|