C20H30N6O2 — CID 45246542
4-[[1-[[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one (PubChem CID 45246542) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-[[1-[[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[1-[[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 45246542 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-[[1-[[1-(cyclohex-3-ene-1-carbonyl)piperidin-4-yl]methyl]triazol-4-yl]methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cn(CC3CCN(C(=O)C4CC=CCC4)CC3)nn2)CCN1 |
| InChI | InChI=1S/C20H30N6O2/c27-19-15-24(11-8-21-19)13-18-14-26(23-22-18)12-16-6-9-25(10-7-16)20(28)17-4-2-1-3-5-17/h1-2,14,16-17H,3-13,15H2,(H,21,27) |
| InChIKey | SVLUCSGLTZMZQI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|