C31H25N5O3 — CID 4518559
2-nitro-N-[[4-[3-phenyl-5-(2-phenylethenyl)-1,3-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide (PubChem CID 4518559) has the molecular formula C31H25N5O3 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-nitro-N-[[4-[3-phenyl-5-(2-phenylethenyl)-1,3-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide.
| Compound Name | 2-nitro-N-[[4-[3-phenyl-5-(2-phenylethenyl)-1,3-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4518559 |
| Molecular Formula | C31H25N5O3 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 2-nitro-N-[[4-[3-phenyl-5-(2-phenylethenyl)-1,3-dihydropyrazol-2-yl]phenyl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(N2NC(C=Cc3ccccc3)=CC2c2ccccc2)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H25N5O3/c37-31(28-13-7-8-14-29(28)36(38)39)33-32-22-24-16-19-27(20-17-24)35-30(25-11-5-2-6-12-25)21-26(34-35)18-15-23-9-3-1-4-10-23/h1-22,30,34H,(H,33,37) |
| InChIKey | CYWVNQFDWWUKTP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|