C23H21NO4S2 — CID 45186351
(E)-N-[[5-(4-methylsulfonylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 45186351) has the molecular formula C23H21NO4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (E)-N-[[5-(4-methylsulfonylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[5-(4-methylsulfonylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 45186351 |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (E)-N-[[5-(4-methylsulfonylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3c(c2)CC(CNC(=O)/C=C/c2cccs2)O3)cc1 |
| InChI | InChI=1S/C23H21NO4S2/c1-30(26,27)21-8-4-16(5-9-21)17-6-10-22-18(13-17)14-19(28-22)15-24-23(25)11-7-20-3-2-12-29-20/h2-13,19H,14-15H2,1H3,(H,24,25)/b11-7+ |
| InChIKey | DUHOMCBZOYOGQO-YRNVUSSQSA-N |
| XLogP | 3.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|