C24H36N2O5 — CID 45188135
4-[1-(3-methoxypropanoyl)piperidin-4-yl]oxy-N-methyl-N-[2-(oxan-2-yl)ethyl]benzamide (PubChem CID 45188135) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is 4-[1-(3-methoxypropanoyl)piperidin-4-yl]oxy-N-methyl-N-[2-(oxan-2-yl)ethyl]benzamide.
| Compound Name | 4-[1-(3-methoxypropanoyl)piperidin-4-yl]oxy-N-methyl-N-[2-(oxan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 45188135 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 4-[1-(3-methoxypropanoyl)piperidin-4-yl]oxy-N-methyl-N-[2-(oxan-2-yl)ethyl]benzamide |
| SMILES | COCCC(=O)N1CCC(Oc2ccc(C(=O)N(C)CCC3CCCCO3)cc2)CC1 |
| InChI | InChI=1S/C24H36N2O5/c1-25(14-10-20-5-3-4-17-30-20)24(28)19-6-8-21(9-7-19)31-22-11-15-26(16-12-22)23(27)13-18-29-2/h6-9,20,22H,3-5,10-18H2,1-2H3 |
| InChIKey | MSPJEMSXVFBPOT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |