C23H27ClN2O4 — CID 67169499
4-[4-(4-chlorophenoxy)piperidine-1-carbonyl]-N-(2-methoxyethyl)-N-methylbenzamide (PubChem CID 67169499) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 4-[4-(4-chlorophenoxy)piperidine-1-carbonyl]-N-(2-methoxyethyl)-N-methylbenzamide.
| Compound Name | 4-[4-(4-chlorophenoxy)piperidine-1-carbonyl]-N-(2-methoxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 67169499 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[4-(4-chlorophenoxy)piperidine-1-carbonyl]-N-(2-methoxyethyl)-N-methylbenzamide |
| SMILES | COCCN(C)C(=O)c1ccc(C(=O)N2CCC(Oc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-25(15-16-29-2)22(27)17-3-5-18(6-4-17)23(28)26-13-11-21(12-14-26)30-20-9-7-19(24)8-10-20/h3-10,21H,11-16H2,1-2H3 |
| InChIKey | CGNCFYVMIRZMFM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |